CAS 96894-64-3 appears in our catalog under these names: (1R,2R)-2-(methoxycarbonyl)cyclohexane-1-carboxylic acid, 95%, (1R,2R)-2-(Methoxycarbonyl)cyclohexanecarboxylic acid, 95%, (1R,2R)-2-(Methoxycarbonyl)cyclohexanecarboxylic acid, 97%, 97%, (1R,2R)-2-(Methoxycarbonyl)cyclohexane-1-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 25g, 10g, 15g, 50g, 75g.
Trans-(1R,2R)-2-methoxycarbonylcyclohexane-1-carboxylic acid (CAS 96894-64-3) is a chemical compound with the molecular formula C9H14O4 and a molecular weight of 186.20 g/mol. IUPAC name: trans-(1R,2R)-2-methoxycarbonylcyclohexane-1-carboxylic acid. InChIKey: BOVPVRGRPPYECC-RNFRBKRXSA-N.
| Molecular formula | C9H14O4 |
|---|---|
| Molecular weight | 186.20 g/mol |
| IUPAC name | trans-(1R,2R)-2-methoxycarbonylcyclohexane-1-carboxylic acid |
| InChIKey | BOVPVRGRPPYECC-RNFRBKRXSA-N |
| SMILES | COC(=O)[C@@H]1CCCC[C@H]1C(=O)O |
Computed by PubChem (NCBI)