CAS 88335-91-5 is the registry number for (1R,2S)-2-(methoxycarbonyl)cyclohexane-1-carboxylic acid, 98%. Offered by: Fluorochem. Available pack sizes: 1g.
Cis-(1R,2S)-2-methoxycarbonylcyclohexane-1-carboxylic acid (CAS 88335-91-5) is a chemical compound with the molecular formula C9H14O4 and a molecular weight of 186.20 g/mol. IUPAC name: cis-(1R,2S)-2-methoxycarbonylcyclohexane-1-carboxylic acid. InChIKey: BOVPVRGRPPYECC-RQJHMYQMSA-N.
| Molecular formula | C9H14O4 |
|---|---|
| Molecular weight | 186.20 g/mol |
| IUPAC name | cis-(1R,2S)-2-methoxycarbonylcyclohexane-1-carboxylic acid |
| InChIKey | BOVPVRGRPPYECC-RQJHMYQMSA-N |
| SMILES | COC(=O)[C@H]1CCCC[C@H]1C(=O)O |
Computed by PubChem (NCBI)