CAS 2484-60-8 appears in our catalog under these names: trans–2–Carbomethoxycyclohexane–1–carboxyic acid, trans-2-Carbomethoxycyclohexane-1-carboxyic acid 95%, TRANS-2-CARBOMETHOXYCYCLOHEXANE-1-CARBOXYLIC ACID, 97%, 97%, trans-2-Carbomethoxycyclohexane-1-carboxyic acid, 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 250mg, 5g, 25g, 100mg.
Trans-(1S,2S)-2-methoxycarbonylcyclohexane-1-carboxylic acid (CAS 2484-60-8) is a chemical compound with the molecular formula C9H14O4 and a molecular weight of 186.20 g/mol. IUPAC name: trans-(1S,2S)-2-methoxycarbonylcyclohexane-1-carboxylic acid. InChIKey: BOVPVRGRPPYECC-BQBZGAKWSA-N.
| Molecular formula | C9H14O4 |
|---|---|
| Molecular weight | 186.20 g/mol |
| IUPAC name | trans-(1S,2S)-2-methoxycarbonylcyclohexane-1-carboxylic acid |
| InChIKey | BOVPVRGRPPYECC-BQBZGAKWSA-N |
| SMILES | COC(=O)[C@H]1CCCC[C@@H]1C(=O)O |
Computed by PubChem (NCBI)