CAS 111971-30-3 is the registry number for 2-Bromo-4-(4-methylphenyl)pyridine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-bromo-4-(4-methylphenyl)pyridine (CAS 111971-30-3) is a chemical compound with the molecular formula C12H10BrN and a molecular weight of 248.12 g/mol. IUPAC name: 2-bromo-4-(4-methylphenyl)pyridine. InChIKey: BIBUKDIQNQELIX-UHFFFAOYSA-N.
| Molecular formula | C12H10BrN |
|---|---|
| Molecular weight | 248.12 g/mol |
| IUPAC name | 2-bromo-4-(4-methylphenyl)pyridine |
| InChIKey | BIBUKDIQNQELIX-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=CC(=NC=C2)Br |
Computed by PubChem (NCBI)