Products 112006-58-3
CAS 112006-58-3 is the registry number for 3-(Dimethylcarbamoyl)pyridine-2-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-(dimethylcarbamoyl)pyridine-2-sulfonyl chloride (CAS 112006-58-3) is a chemical compound with the molecular formula C8H9ClN2O3S and a molecular weight of 248.69 g/mol. IUPAC name: 3-(dimethylcarbamoyl)pyridine-2-sulfonyl chloride. InChIKey: BCZIPIDWLIDQGG-UHFFFAOYSA-N.
| Molecular formula | C8H9ClN2O3S |
|---|---|
| Molecular weight | 248.69 g/mol |
| IUPAC name | 3-(dimethylcarbamoyl)pyridine-2-sulfonyl chloride |
| InChIKey | BCZIPIDWLIDQGG-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C1=C(N=CC=C1)S(=O)(=O)Cl |
Computed by PubChem (NCBI)