Products 910037-13-7

CAS 910037-13-7 is the registry number for 4-Methyl-3,4-dihydro-2H-pyrido[3,2-b][1,4]oxazine-7-sulfonyl chloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

4-methyl-2,3-dihydropyrido[3,2-b][1,4]oxazine-7-sulfonyl chloride (CAS 910037-13-7) is a chemical compound with the molecular formula C8H9ClN2O3S and a molecular weight of 248.69 g/mol. IUPAC name: 4-methyl-2,3-dihydropyrido[3,2-b][1,4]oxazine-7-sulfonyl chloride. InChIKey: OCVVGDZOPPMLIB-UHFFFAOYSA-N.

Identity
Molecular formulaC8H9ClN2O3S
Molecular weight248.69 g/mol
IUPAC name4-methyl-2,3-dihydropyrido[3,2-b][1,4]oxazine-7-sulfonyl chloride
InChIKeyOCVVGDZOPPMLIB-UHFFFAOYSA-N
SMILESCN1CCOC2=C1N=CC(=C2)S(=O)(=O)Cl

Computed by PubChem (NCBI)