CAS 910037-13-7 is the registry number for 4-Methyl-3,4-dihydro-2H-pyrido[3,2-b][1,4]oxazine-7-sulfonyl chloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-methyl-2,3-dihydropyrido[3,2-b][1,4]oxazine-7-sulfonyl chloride (CAS 910037-13-7) is a chemical compound with the molecular formula C8H9ClN2O3S and a molecular weight of 248.69 g/mol. IUPAC name: 4-methyl-2,3-dihydropyrido[3,2-b][1,4]oxazine-7-sulfonyl chloride. InChIKey: OCVVGDZOPPMLIB-UHFFFAOYSA-N.
| Molecular formula | C8H9ClN2O3S |
|---|---|
| Molecular weight | 248.69 g/mol |
| IUPAC name | 4-methyl-2,3-dihydropyrido[3,2-b][1,4]oxazine-7-sulfonyl chloride |
| InChIKey | OCVVGDZOPPMLIB-UHFFFAOYSA-N |
| SMILES | CN1CCOC2=C1N=CC(=C2)S(=O)(=O)Cl |
Computed by PubChem (NCBI)