Products 869951-10-0

CAS 869951-10-0 is the registry number for Methyl (2-[(chloroacetyl)amino]-1,3-thiazol-5-yl)acetate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

Methyl 2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-5-yl]acetate (CAS 869951-10-0) is a chemical compound with the molecular formula C8H9ClN2O3S and a molecular weight of 248.69 g/mol. IUPAC name: methyl 2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-5-yl]acetate. InChIKey: KDOOFRJSQNSJIG-UHFFFAOYSA-N.

Identity
Molecular formulaC8H9ClN2O3S
Molecular weight248.69 g/mol
IUPAC namemethyl 2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-5-yl]acetate
InChIKeyKDOOFRJSQNSJIG-UHFFFAOYSA-N
SMILESCOC(=O)CC1=CN=C(S1)NC(=O)CCl

Computed by PubChem (NCBI)