CAS 19900-93-7 appears in our catalog under these names: Diazoxide Impurity 2, Diazoxide Impurity 5. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
N-(2-amino-5-chlorophenyl)sulfonylacetamide (CAS 19900-93-7) is a chemical compound with the molecular formula C8H9ClN2O3S and a molecular weight of 248.69 g/mol. IUPAC name: N-(2-amino-5-chlorophenyl)sulfonylacetamide. InChIKey: IQGPTJQZEMLUJN-UHFFFAOYSA-N.
| Molecular formula | C8H9ClN2O3S |
|---|---|
| Molecular weight | 248.69 g/mol |
| IUPAC name | N-(2-amino-5-chlorophenyl)sulfonylacetamide |
| InChIKey | IQGPTJQZEMLUJN-UHFFFAOYSA-N |
| SMILES | CC(=O)NS(=O)(=O)C1=C(C=CC(=C1)Cl)N |
Computed by PubChem (NCBI)