CAS 70661-64-2 appears in our catalog under these names: 1-((4-Chlorophenyl)sulfonyl)-2-(hydroxyimino)eth-2-ylamine, 2-[(4-Chlorophenyl)sulfonyl]-N'-hydroxyethanimid-amide, 98%. Offered by: Biosynth, Fluorochem. Available pack sizes: 25g, 10g, 1g, 5g.
2-(4-chlorophenyl)sulfonyl-N'-hydroxyethanimidamide (CAS 70661-64-2) is a chemical compound with the molecular formula C8H9ClN2O3S and a molecular weight of 248.69 g/mol. IUPAC name: 2-(4-chlorophenyl)sulfonyl-N'-hydroxyethanimidamide. InChIKey: RJWJKIYKFMICDI-UHFFFAOYSA-N.
| Molecular formula | C8H9ClN2O3S |
|---|---|
| Molecular weight | 248.69 g/mol |
| IUPAC name | 2-(4-chlorophenyl)sulfonyl-N'-hydroxyethanimidamide |
| InChIKey | RJWJKIYKFMICDI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1S(=O)(=O)C/C(=N/O)/N)Cl |
Computed by PubChem (NCBI)