CAS 51813-38-8 appears in our catalog under these names: Cephalosporin Impurity 8, Cefepime Impurity 12, Des-(2-(2-Aminothiazol-4-yl)-2-(hydroxyimino)acetaldehyde) 3-(Chloromethyl) Cefdinir. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 750mg.
(6R,7R)-7-amino-3-(chloromethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (CAS 51813-38-8) is a chemical compound with the molecular formula C8H9ClN2O3S and a molecular weight of 248.69 g/mol. IUPAC name: (6R,7R)-7-amino-3-(chloromethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid. InChIKey: BUDIODLBJBTUJD-CLZZGJSISA-N.
| Molecular formula | C8H9ClN2O3S |
|---|---|
| Molecular weight | 248.69 g/mol |
| IUPAC name | (6R,7R)-7-amino-3-(chloromethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| InChIKey | BUDIODLBJBTUJD-CLZZGJSISA-N |
| SMILES | C1C(=C(N2[C@H](S1)[C@@H](C2=O)N)C(=O)O)CCl |
Computed by PubChem (NCBI)