Products 1951444-69-1
CAS 1951444-69-1 is the registry number for Ethyl 4-chloro-2-(methylsulfinyl)pyrimidine-5-carboxylate. Offered by: Biosynth. Available pack sizes: 1000mg, 5000mg, 10000mg.
Ethyl 4-chloro-2-methylsulfinylpyrimidine-5-carboxylate (CAS 1951444-69-1) is a chemical compound with the molecular formula C8H9ClN2O3S and a molecular weight of 248.69 g/mol. IUPAC name: ethyl 4-chloro-2-methylsulfinylpyrimidine-5-carboxylate. InChIKey: BNBJWBKLXJFIKV-UHFFFAOYSA-N.
| Molecular formula | C8H9ClN2O3S |
|---|---|
| Molecular weight | 248.69 g/mol |
| IUPAC name | ethyl 4-chloro-2-methylsulfinylpyrimidine-5-carboxylate |
| InChIKey | BNBJWBKLXJFIKV-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CN=C(N=C1Cl)S(=O)C |
Computed by PubChem (NCBI)