CAS 1124197-63-2 is the registry number for 2,4-Difluoro-Alpha-(1H-1,2,4-triazolyl)acetophenone-d2. Offered by: TRC. Available pack sizes: 100mg, 10mg.
2,2-dideuterio-1-(2,4-difluorophenyl)-2-(1,2,4-triazol-1-yl)ethanone (CAS 1124197-63-2) is a chemical compound with the molecular formula C10H7F2N3O and a molecular weight of 225.19 g/mol. IUPAC name: 2,2-dideuterio-1-(2,4-difluorophenyl)-2-(1,2,4-triazol-1-yl)ethanone. InChIKey: XCHRPVARHBCFMJ-APZFVMQVSA-N.
| Molecular formula | C10H7F2N3O |
|---|---|
| Molecular weight | 225.19 g/mol |
| IUPAC name | 2,2-dideuterio-1-(2,4-difluorophenyl)-2-(1,2,4-triazol-1-yl)ethanone |
| InChIKey | XCHRPVARHBCFMJ-APZFVMQVSA-N |
| SMILES | [2H]C([2H])(C(=O)C1=C(C=C(C=C1)F)F)N2C=NC=N2 |
Computed by PubChem (NCBI)