CAS 1449785-88-9 appears in our catalog under these names: Voriconazole Impurity 51, Voriconazole Impurity 10 (UK-115191). Offered by: Chemat Brand. Available pack sizes: on request.
(Z)-1-(2,4-difluorophenyl)-2-(1,2,4-triazol-1-yl)ethenol (CAS 1449785-88-9) is a chemical compound with the molecular formula C10H7F2N3O and a molecular weight of 223.18 g/mol. IUPAC name: (Z)-1-(2,4-difluorophenyl)-2-(1,2,4-triazol-1-yl)ethenol. InChIKey: DDLPRYJTDUIELF-WMZJFQQLSA-N.
| Molecular formula | C10H7F2N3O |
|---|---|
| Molecular weight | 223.18 g/mol |
| IUPAC name | (Z)-1-(2,4-difluorophenyl)-2-(1,2,4-triazol-1-yl)ethenol |
| InChIKey | DDLPRYJTDUIELF-WMZJFQQLSA-N |
| SMILES | C1=CC(=C(C=C1F)F)/C(=C/N2C=NC=N2)/O |
Computed by PubChem (NCBI)