CAS 86404-63-9 appears in our catalog under these names: Fluconazole EP Impurity E (Voriconazole EP Impurity A), Fluconazole EP Impurity E, 2,4-Difluoro-alpha-(1H-1,2,4-triazolyl)acetophenone, >95% (HPLC), 2,4-Difluoro-a-(1H-1,2,4-triazolyl)acetophenone, >95% (HPLC), 1-(2,4-Difluorophenyl)-2-(1H-1,2,4-triazol-1-yl)ethanone. Offered by: Chemat Brand, TRC, Mikromol, Thermo Scientific (Alfa Aesar), TCI. Available pack sizes: on request, 1g, 250g, 5g, 25mg, 25g, 1kg, 10g.
1-(2,4-difluorophenyl)-2-(1,2,4-triazol-1-yl)ethanone (CAS 86404-63-9) is a chemical compound with the molecular formula C10H7F2N3O and a molecular weight of 223.18 g/mol. IUPAC name: 1-(2,4-difluorophenyl)-2-(1,2,4-triazol-1-yl)ethanone. InChIKey: XCHRPVARHBCFMJ-UHFFFAOYSA-N.
| Molecular formula | C10H7F2N3O |
|---|---|
| Molecular weight | 223.18 g/mol |
| IUPAC name | 1-(2,4-difluorophenyl)-2-(1,2,4-triazol-1-yl)ethanone |
| InChIKey | XCHRPVARHBCFMJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)F)C(=O)CN2C=NC=N2 |
Computed by PubChem (NCBI)