CAS 168479-96-7 appears in our catalog under these names: Voriconazole Impurity 49, 1-(2,4-Difluorophenyl)-2-(4H-1,2,4-triazol-4-yl)ethanone, >95% (HPLC). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg, 250mg, 500mg.
1-(2,4-difluorophenyl)-2-(1,2,4-triazol-4-yl)ethanone (CAS 168479-96-7) is a chemical compound with the molecular formula C10H7F2N3O and a molecular weight of 223.18 g/mol. IUPAC name: 1-(2,4-difluorophenyl)-2-(1,2,4-triazol-4-yl)ethanone. InChIKey: SGNADDGGXCXHRX-UHFFFAOYSA-N.
| Molecular formula | C10H7F2N3O |
|---|---|
| Molecular weight | 223.18 g/mol |
| IUPAC name | 1-(2,4-difluorophenyl)-2-(1,2,4-triazol-4-yl)ethanone |
| InChIKey | SGNADDGGXCXHRX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)F)C(=O)CN2C=NN=C2 |
Computed by PubChem (NCBI)