CAS 1157938-97-0 appears in our catalog under these names: 1-(2,5-Difluorophenyl)-2-(1H-1,2,4-triazol-1-yl)ethanone, 97%, 97%, Isavuconazole Impurity 60, 1–(2,5–difluorophenyl)–2–(1H–1,2,4–triazol–1–yl)ethanone, 1-(2,5-Difluorophenyl)-2-(1H-1,2,4-triazol-1-yl)ethanone, 97%. Offered by: Chemat, Chemat Brand, GLPBio, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 100mg, on request.
1-(2,5-difluorophenyl)-2-(1,2,4-triazol-1-yl)ethanone (CAS 1157938-97-0) is a chemical compound with the molecular formula C10H7F2N3O and a molecular weight of 223.18 g/mol. IUPAC name: 1-(2,5-difluorophenyl)-2-(1,2,4-triazol-1-yl)ethanone. InChIKey: TYSGXZUZAJOVML-UHFFFAOYSA-N.
| Molecular formula | C10H7F2N3O |
|---|---|
| Molecular weight | 223.18 g/mol |
| IUPAC name | 1-(2,5-difluorophenyl)-2-(1,2,4-triazol-1-yl)ethanone |
| InChIKey | TYSGXZUZAJOVML-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)C(=O)CN2C=NC=N2)F |
Computed by PubChem (NCBI)