CAS 2692637-88-8 is the registry number for 2-(Difluoromethyl)-6-vinylpyrido[3,2-d]pyrimidin-4(3H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(difluoromethyl)-6-ethenyl-3H-pyrido[3,2-d]pyrimidin-4-one (CAS 2692637-88-8) is a chemical compound with the molecular formula C10H7F2N3O and a molecular weight of 223.18 g/mol. IUPAC name: 2-(difluoromethyl)-6-ethenyl-3H-pyrido[3,2-d]pyrimidin-4-one. InChIKey: JLPKOVJWBHKNPF-UHFFFAOYSA-N.
| Molecular formula | C10H7F2N3O |
|---|---|
| Molecular weight | 223.18 g/mol |
| IUPAC name | 2-(difluoromethyl)-6-ethenyl-3H-pyrido[3,2-d]pyrimidin-4-one |
| InChIKey | JLPKOVJWBHKNPF-UHFFFAOYSA-N |
| SMILES | C=CC1=NC2=C(C=C1)N=C(NC2=O)C(F)F |
Computed by PubChem (NCBI)