CAS 1157981-64-0 is the registry number for Voriconazole Impurity 16. Offered by: Chemat Brand. Available pack sizes: on request.
1-(2,6-difluorophenyl)-2-(1,2,4-triazol-1-yl)ethanone (CAS 1157981-64-0) is a chemical compound with the molecular formula C10H7F2N3O and a molecular weight of 223.18 g/mol. IUPAC name: 1-(2,6-difluorophenyl)-2-(1,2,4-triazol-1-yl)ethanone. InChIKey: OZUAKSZHVZQFBT-UHFFFAOYSA-N.
| Molecular formula | C10H7F2N3O |
|---|---|
| Molecular weight | 223.18 g/mol |
| IUPAC name | 1-(2,6-difluorophenyl)-2-(1,2,4-triazol-1-yl)ethanone |
| InChIKey | OZUAKSZHVZQFBT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)C(=O)CN2C=NC=N2)F |
Computed by PubChem (NCBI)