CAS 1124290-11-4 is the registry number for 4,5-Dimethoxy-2-nitrobenzyl methacrylate, 95%. Offered by: AmBeed. Available pack sizes: 5g.
(4,5-dimethoxy-2-nitrophenyl)methyl 2-methylprop-2-enoate (CAS 1124290-11-4) is a chemical compound with the molecular formula C13H15NO6 and a molecular weight of 281.26 g/mol. IUPAC name: (4,5-dimethoxy-2-nitrophenyl)methyl 2-methylprop-2-enoate. InChIKey: AXMTWODTDWNTAV-UHFFFAOYSA-N.
| Molecular formula | C13H15NO6 |
|---|---|
| Molecular weight | 281.26 g/mol |
| IUPAC name | (4,5-dimethoxy-2-nitrophenyl)methyl 2-methylprop-2-enoate |
| InChIKey | AXMTWODTDWNTAV-UHFFFAOYSA-N |
| SMILES | CC(=C)C(=O)OCC1=CC(=C(C=C1[N+](=O)[O-])OC)OC |
Computed by PubChem (NCBI)