CAS 112500-89-7 appears in our catalog under these names: 6-aldehydo-Isoophiopogonone B, ≥98%, ≥98%, 6-Aldehydoisoophiopogonone B. Offered by: Chemat, MedChemExpress. Available pack sizes: 5mg, 10mg, 20mg, 50mg, 10 mg, 1 mg, 5 mg.
5,7-dihydroxy-3-[(4-methoxyphenyl)methyl]-8-methyl-4-oxochromene-6-carbaldehyde (CAS 112500-89-7) is a chemical compound with the molecular formula C19H16O6 and a molecular weight of 340.3 g/mol. IUPAC name: 5,7-dihydroxy-3-[(4-methoxyphenyl)methyl]-8-methyl-4-oxochromene-6-carbaldehyde. InChIKey: MPUAHKMJGSMMIL-UHFFFAOYSA-N.
| Molecular formula | C19H16O6 |
|---|---|
| Molecular weight | 340.3 g/mol |
| IUPAC name | 5,7-dihydroxy-3-[(4-methoxyphenyl)methyl]-8-methyl-4-oxochromene-6-carbaldehyde |
| InChIKey | MPUAHKMJGSMMIL-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C2=C1OC=C(C2=O)CC3=CC=C(C=C3)OC)O)C=O)O |
Computed by PubChem (NCBI)