Products 384362-18-9

CAS 384362-18-9 is the registry number for ([4-(4-Methoxyphenyl)-8-methyl-2-oxo-2h-chromen-7-yl]oxy)acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

2-[4-(4-methoxyphenyl)-8-methyl-2-oxochromen-7-yl]oxyacetic acid (CAS 384362-18-9) is a chemical compound with the molecular formula C19H16O6 and a molecular weight of 340.3 g/mol. IUPAC name: 2-[4-(4-methoxyphenyl)-8-methyl-2-oxochromen-7-yl]oxyacetic acid. InChIKey: HXRDDBNOBBLTLY-UHFFFAOYSA-N.

Identity
Molecular formulaC19H16O6
Molecular weight340.3 g/mol
IUPAC name2-[4-(4-methoxyphenyl)-8-methyl-2-oxochromen-7-yl]oxyacetic acid
InChIKeyHXRDDBNOBBLTLY-UHFFFAOYSA-N
SMILESCC1=C(C=CC2=C1OC(=O)C=C2C3=CC=C(C=C3)OC)OCC(=O)O

Computed by PubChem (NCBI)