CAS 72221-11-5 is the registry number for 7–(2–(4–Hydroxy–3–methoxyphenyl)–2–oxoethoxy)–4–methyl–chromen–2–one. Offered by: GLPBio. Available pack sizes: 1mg, 5mg.
7-[2-(4-hydroxy-3-methoxyphenyl)-2-oxoethoxy]-4-methylchromen-2-one (CAS 72221-11-5) is a chemical compound with the molecular formula C19H16O6 and a molecular weight of 340.3 g/mol. IUPAC name: 7-[2-(4-hydroxy-3-methoxyphenyl)-2-oxoethoxy]-4-methylchromen-2-one. InChIKey: ZNKPZWDHOHRPPA-UHFFFAOYSA-N.
| Molecular formula | C19H16O6 |
|---|---|
| Molecular weight | 340.3 g/mol |
| IUPAC name | 7-[2-(4-hydroxy-3-methoxyphenyl)-2-oxoethoxy]-4-methylchromen-2-one |
| InChIKey | ZNKPZWDHOHRPPA-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)OC2=C1C=CC(=C2)OCC(=O)C3=CC(=C(C=C3)O)OC |
Computed by PubChem (NCBI)