CAS 151417-66-2 is the registry number for R24. Offered by: MedChemExpress. Available pack sizes: Get quote.
3,6-bis(oxiran-2-ylmethoxy)xanthen-9-one (CAS 151417-66-2) is a chemical compound with the molecular formula C19H16O6 and a molecular weight of 340.3 g/mol. IUPAC name: 3,6-bis(oxiran-2-ylmethoxy)xanthen-9-one. InChIKey: UZQSJQFHCZAIQQ-UHFFFAOYSA-N.
| Molecular formula | C19H16O6 |
|---|---|
| Molecular weight | 340.3 g/mol |
| IUPAC name | 3,6-bis(oxiran-2-ylmethoxy)xanthen-9-one |
| InChIKey | UZQSJQFHCZAIQQ-UHFFFAOYSA-N |
| SMILES | C1C(O1)COC2=CC3=C(C=C2)C(=O)C4=C(O3)C=C(C=C4)OCC5CO5 |
Computed by PubChem (NCBI)