Products 1316224-74-4
CAS 1316224-74-4 appears in our catalog under these names: 8-Formylophiopogonone B, 8-formyl ophiopogonone B, ≥98%. Offered by: MedChemExpress, Chemat. Available pack sizes: Get quote, 5mg.
5,7-dihydroxy-3-[(4-methoxyphenyl)methyl]-6-methyl-4-oxochromene-8-carbaldehyde (CAS 1316224-74-4) is a chemical compound with the molecular formula C19H16O6 and a molecular weight of 340.3 g/mol. IUPAC name: 5,7-dihydroxy-3-[(4-methoxyphenyl)methyl]-6-methyl-4-oxochromene-8-carbaldehyde. InChIKey: HDJKXNHPMVFURN-UHFFFAOYSA-N.
| Molecular formula | C19H16O6 |
|---|---|
| Molecular weight | 340.3 g/mol |
| IUPAC name | 5,7-dihydroxy-3-[(4-methoxyphenyl)methyl]-6-methyl-4-oxochromene-8-carbaldehyde |
| InChIKey | HDJKXNHPMVFURN-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C2C(=C1O)C(=O)C(=CO2)CC3=CC=C(C=C3)OC)C=O)O |
Computed by PubChem (NCBI)