CAS 74805-90-6 appears in our catalog under these names: Methylophiopogonone A/ 95.65% (existing batch purity), Methylophiopogonone A, 99.87% ,, 99.87% ,, Methylophiopogonone A (Standard), Methylophiopogonone A, 99.84%. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, Get quote, 5 mg, 10mM/1mL.
3-(1,3-benzodioxol-5-ylmethyl)-5,7-dihydroxy-6,8-dimethylchromen-4-one (CAS 74805-90-6) is a chemical compound with the molecular formula C19H16O6 and a molecular weight of 340.3 g/mol. IUPAC name: 3-(1,3-benzodioxol-5-ylmethyl)-5,7-dihydroxy-6,8-dimethylchromen-4-one. InChIKey: AUTZLTCWRDPAPV-UHFFFAOYSA-N.
| Molecular formula | C19H16O6 |
|---|---|
| Molecular weight | 340.3 g/mol |
| IUPAC name | 3-(1,3-benzodioxol-5-ylmethyl)-5,7-dihydroxy-6,8-dimethylchromen-4-one |
| InChIKey | AUTZLTCWRDPAPV-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C2C(=C1O)C(=O)C(=CO2)CC3=CC4=C(C=C3)OCO4)C)O |
Computed by PubChem (NCBI)