CAS 60831-46-1 appears in our catalog under these names: (1E,6E)-1,7-Bis(3,4-dihydroxyphenyl)hepta-1,6-diene-3,5-dione, 98%, Didemethyl Curcumin, >95% (HPLC), Bisdemethylcurcumin, Di-O-demethylcurcumin. Offered by: Chemat Brand, TRC, Biosynth, MedChemExpress. Available pack sizes: on request, 10mg, 25mg, 5mg, 25 mg, 10 mg, 1 mg, 5 mg.
(1E,6E)-1,7-bis(3,4-dihydroxyphenyl)hepta-1,6-diene-3,5-dione (CAS 60831-46-1) is a chemical compound with the molecular formula C19H16O6 and a molecular weight of 340.3 g/mol. IUPAC name: (1E,6E)-1,7-bis(3,4-dihydroxyphenyl)hepta-1,6-diene-3,5-dione. InChIKey: OJFGQVZAISEIPG-IJIVKGSJSA-N.
| Molecular formula | C19H16O6 |
|---|---|
| Molecular weight | 340.3 g/mol |
| IUPAC name | (1E,6E)-1,7-bis(3,4-dihydroxyphenyl)hepta-1,6-diene-3,5-dione |
| InChIKey | OJFGQVZAISEIPG-IJIVKGSJSA-N |
| SMILES | C1=CC(=C(C=C1/C=C/C(=O)CC(=O)/C=C/C2=CC(=C(C=C2)O)O)O)O |
Computed by PubChem (NCBI)