Products 1126424-50-7
CAS 1126424-50-7 is the registry number for 1-tert-Butyl 6-methyl 1H-indazole-1,6-dicarboxylate, 95%. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg.
1-O-tert-butyl 6-O-methyl indazole-1,6-dicarboxylate (CAS 1126424-50-7) is a chemical compound with the molecular formula C14H16N2O4 and a molecular weight of 276.29 g/mol. IUPAC name: 1-O-tert-butyl 6-O-methyl indazole-1,6-dicarboxylate. InChIKey: QWMRWZQWWSEPJS-UHFFFAOYSA-N.
| Molecular formula | C14H16N2O4 |
|---|---|
| Molecular weight | 276.29 g/mol |
| IUPAC name | 1-O-tert-butyl 6-O-methyl indazole-1,6-dicarboxylate |
| InChIKey | QWMRWZQWWSEPJS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C2=C(C=CC(=C2)C(=O)OC)C=N1 |
Computed by PubChem (NCBI)
Synonyms:
1-tert-Butyl 6-methyl 1H-indazole-1,6-dicarboxylate, tert-Butyl methyl 1H-indazole-1,6-dicarboxylate, 1-O-tert-butyl 6-O-methyl indazole-1,6-dicarboxylate, 1-tert-Butyl 6-methyl 1H-indazole-16-dicarboxylate, Methyl 1-Boc-1H-indazole-6-carboxylate, 1-tert-Butyl6-methyl1H-indazole-1,6-dicarboxylate, O1-tert-butyl O6-methyl indazole-1,6-dicarboxylate, 1-(tert-butyl) 6-methyl 1H-indazole-1,6-dicarboxylate