CAS 112757-17-2 is the registry number for N-Lactylleucine, 99.88%. Offered by: MedChemExpress. Available pack sizes: 10 mg, 5 mg, 50 mg, 100 mg, 25 mg.
(2S)-2-(2-hydroxypropanoylamino)-4-methylpentanoic acid (CAS 112757-17-2) is a chemical compound with the molecular formula C9H17NO4 and a molecular weight of 203.24 g/mol. IUPAC name: (2S)-2-(2-hydroxypropanoylamino)-4-methylpentanoic acid. InChIKey: BUMIGZVUJKNXCO-MLWJPKLSSA-N.
| Molecular formula | C9H17NO4 |
|---|---|
| Molecular weight | 203.24 g/mol |
| IUPAC name | (2S)-2-(2-hydroxypropanoylamino)-4-methylpentanoic acid |
| InChIKey | BUMIGZVUJKNXCO-MLWJPKLSSA-N |
| SMILES | CC(C)C[C@@H](C(=O)O)NC(=O)C(C)O |
Computed by PubChem (NCBI)