CAS 1130061-52-7 is the registry number for Lenalidomide-d4. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-(7-amino-3-oxo-1H-isoindol-2-yl)-3,3,4,4-tetradeuteriopiperidine-2,6-dione (CAS 1130061-52-7) is a chemical compound with the molecular formula C13H13N3O3 and a molecular weight of 263.28 g/mol. IUPAC name: 5-(7-amino-3-oxo-1H-isoindol-2-yl)-3,3,4,4-tetradeuteriopiperidine-2,6-dione. InChIKey: GOTYRUGSSMKFNF-CQOLUAMGSA-N.
| Molecular formula | C13H13N3O3 |
|---|---|
| Molecular weight | 263.28 g/mol |
| IUPAC name | 5-(7-amino-3-oxo-1H-isoindol-2-yl)-3,3,4,4-tetradeuteriopiperidine-2,6-dione |
| InChIKey | GOTYRUGSSMKFNF-CQOLUAMGSA-N |
| SMILES | [2H]C1(C(C(=O)NC(=O)C1([2H])[2H])N2CC3=C(C2=O)C=CC=C3N)[2H] |
Computed by PubChem (NCBI)