CAS 202271-91-8 appears in our catalog under these names: S-Lenalidomide, (S)-Lenalidomide 98%, (3S)-3-(4-Amino-1-oxo-1,3-dihydro-2h-isoindol-2-yl)piperidine-2,6-dione, 98%, 98%. Offered by: Chemat Brand, Biosynth, Ambeed, Chemat. Available pack sizes: on request, 1g, 2g, 50mg, 100mg, 250mg, 5g.
(3S)-3-(7-amino-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione (CAS 202271-91-8) is a chemical compound with the molecular formula C13H13N3O3 and a molecular weight of 259.26 g/mol. IUPAC name: (3S)-3-(7-amino-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione. InChIKey: GOTYRUGSSMKFNF-JTQLQIEISA-N.
| Molecular formula | C13H13N3O3 |
|---|---|
| Molecular weight | 259.26 g/mol |
| IUPAC name | (3S)-3-(7-amino-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione |
| InChIKey | GOTYRUGSSMKFNF-JTQLQIEISA-N |
| SMILES | C1CC(=O)NC(=O)[C@H]1N2CC3=C(C2=O)C=CC=C3N |
Computed by PubChem (NCBI)