Products 1227162-34-6
CAS 1227162-34-6 appears in our catalog under these names: Lenalidomide-d5, Lenalidomide–d5, Lenalidomide-d5, 99%, 99%, Lenalidomide-d5, 99.32%. Offered by: Chemat Brand, GLPBio, Chemat, MedChemExpress. Available pack sizes: on request, 1mg, 500μg, 1 mg.
3-(7-amino-3-oxo-1H-isoindol-2-yl)-3,4,4,5,5-pentadeuteriopiperidine-2,6-dione (CAS 1227162-34-6) is a chemical compound with the molecular formula C13H13N3O3 and a molecular weight of 264.29 g/mol. IUPAC name: 3-(7-amino-3-oxo-1H-isoindol-2-yl)-3,4,4,5,5-pentadeuteriopiperidine-2,6-dione. InChIKey: GOTYRUGSSMKFNF-QTQWIGFBSA-N.
| Molecular formula | C13H13N3O3 |
|---|---|
| Molecular weight | 264.29 g/mol |
| IUPAC name | 3-(7-amino-3-oxo-1H-isoindol-2-yl)-3,4,4,5,5-pentadeuteriopiperidine-2,6-dione |
| InChIKey | GOTYRUGSSMKFNF-QTQWIGFBSA-N |
| SMILES | [2H]C1(C(=O)NC(=O)C(C1([2H])[2H])([2H])N2CC3=C(C2=O)C=CC=C3N)[2H] |
Computed by PubChem (NCBI)