Products 113072-23-4
CAS 113072-23-4 is the registry number for 5-Chloro-2-(3-chloropropyl)-1,3-benzoxazole, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g.
5-chloro-2-(3-chloropropyl)-1,3-benzoxazole (CAS 113072-23-4) is a chemical compound with the molecular formula C10H9Cl2NO and a molecular weight of 230.09 g/mol. IUPAC name: 5-chloro-2-(3-chloropropyl)-1,3-benzoxazole. InChIKey: SKPVQUBFXPHZKS-UHFFFAOYSA-N.
| Molecular formula | C10H9Cl2NO |
|---|---|
| Molecular weight | 230.09 g/mol |
| IUPAC name | 5-chloro-2-(3-chloropropyl)-1,3-benzoxazole |
| InChIKey | SKPVQUBFXPHZKS-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)N=C(O2)CCCCl |
Computed by PubChem (NCBI)