CAS 2385310-50-7 is the registry number for Ziprasidone Impurity 32. Offered by: Chemat Brand. Available pack sizes: on request.
6-chloro-7-(2-chloroethyl)-1H-indol-2-ol (CAS 2385310-50-7) is a chemical compound with the molecular formula C10H9Cl2NO and a molecular weight of 230.09 g/mol. IUPAC name: 6-chloro-7-(2-chloroethyl)-1H-indol-2-ol. InChIKey: UCQPYSBYRNVGQH-UHFFFAOYSA-N.
| Molecular formula | C10H9Cl2NO |
|---|---|
| Molecular weight | 230.09 g/mol |
| IUPAC name | 6-chloro-7-(2-chloroethyl)-1H-indol-2-ol |
| InChIKey | UCQPYSBYRNVGQH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C2=C1C=C(N2)O)CCCl)Cl |
Computed by PubChem (NCBI)