CAS 293325-19-6 is the registry number for 1-(2,5-Dichlorophenyl)pyrrolidin-2-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(2,5-dichlorophenyl)pyrrolidin-2-one (CAS 293325-19-6) is a chemical compound with the molecular formula C10H9Cl2NO and a molecular weight of 230.09 g/mol. IUPAC name: 1-(2,5-dichlorophenyl)pyrrolidin-2-one. InChIKey: GYDHDIHWONHLAA-UHFFFAOYSA-N.
| Molecular formula | C10H9Cl2NO |
|---|---|
| Molecular weight | 230.09 g/mol |
| IUPAC name | 1-(2,5-dichlorophenyl)pyrrolidin-2-one |
| InChIKey | GYDHDIHWONHLAA-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1)C2=C(C=CC(=C2)Cl)Cl |
Computed by PubChem (NCBI)