CAS 54888-30-1 appears in our catalog under these names: N-(2,2-Dichlorovinyl)-4-methylbenzamide, 97% mix TBC as stabilizer, N-(2,2-Dichloroethenyl)-4-methylbenzamide. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 2,5g, 250mg.
N-(2,2-dichloroethenyl)-4-methylbenzamide (CAS 54888-30-1) is a chemical compound with the molecular formula C10H9Cl2NO and a molecular weight of 230.09 g/mol. IUPAC name: N-(2,2-dichloroethenyl)-4-methylbenzamide. InChIKey: HPFANBPWWVMZQZ-UHFFFAOYSA-N.
| Molecular formula | C10H9Cl2NO |
|---|---|
| Molecular weight | 230.09 g/mol |
| IUPAC name | N-(2,2-dichloroethenyl)-4-methylbenzamide |
| InChIKey | HPFANBPWWVMZQZ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(=O)NC=C(Cl)Cl |
Computed by PubChem (NCBI)