CAS 876937-44-9 is the registry number for 2,3-Dichloro-N-cyclopropylbenzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
2,3-dichloro-N-cyclopropylbenzamide (CAS 876937-44-9) is a chemical compound with the molecular formula C10H9Cl2NO and a molecular weight of 230.09 g/mol. IUPAC name: 2,3-dichloro-N-cyclopropylbenzamide. InChIKey: RZPOEUNYNZFFLF-UHFFFAOYSA-N.
| Molecular formula | C10H9Cl2NO |
|---|---|
| Molecular weight | 230.09 g/mol |
| IUPAC name | 2,3-dichloro-N-cyclopropylbenzamide |
| InChIKey | RZPOEUNYNZFFLF-UHFFFAOYSA-N |
| SMILES | C1CC1NC(=O)C2=C(C(=CC=C2)Cl)Cl |
Computed by PubChem (NCBI)