CAS 22558-37-8 appears in our catalog under these names: 4-(2,6-Dichlorophenyl)pyrrolidin-2-one, 98%, 4-(2,6-Dichlorophenyl)-2-pyrrolidinone. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 1g.
4-(2,6-dichlorophenyl)pyrrolidin-2-one (CAS 22558-37-8) is a chemical compound with the molecular formula C10H9Cl2NO and a molecular weight of 230.09 g/mol. IUPAC name: 4-(2,6-dichlorophenyl)pyrrolidin-2-one. InChIKey: OPQMJMSXNZDYGC-UHFFFAOYSA-N.
| Molecular formula | C10H9Cl2NO |
|---|---|
| Molecular weight | 230.09 g/mol |
| IUPAC name | 4-(2,6-dichlorophenyl)pyrrolidin-2-one |
| InChIKey | OPQMJMSXNZDYGC-UHFFFAOYSA-N |
| SMILES | C1C(CNC1=O)C2=C(C=CC=C2Cl)Cl |
Computed by PubChem (NCBI)