CAS 4053-45-6 appears in our catalog under these names: 5-(Chloromethyl)-8-quinolinol hydrochloride, 96%, 5-(Chloromethyl)-8-quinolinol Hydrochloride, 95%, 95%, 5-(Chloromethyl)quinolin-8-ol hydrochloride, 95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 10g, 25g, 1g, 5g, 100mg, 250mg.
5-(chloromethyl)quinolin-8-ol;hydrochloride (CAS 4053-45-6) is a chemical compound with the molecular formula C10H9Cl2NO and a molecular weight of 230.09 g/mol. IUPAC name: 5-(chloromethyl)quinolin-8-ol;hydrochloride. InChIKey: BDQGTRWOFVSOQX-UHFFFAOYSA-N.
| Molecular formula | C10H9Cl2NO |
|---|---|
| Molecular weight | 230.09 g/mol |
| IUPAC name | 5-(chloromethyl)quinolin-8-ol;hydrochloride |
| InChIKey | BDQGTRWOFVSOQX-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2N=C1)O)CCl.Cl |
Computed by PubChem (NCBI)