CAS 1131580-22-7 is the registry number for 6-(4-Methoxyphenyl)-3-methylimidazo[2,1-b][1,3]thiazole-2-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 250mg, 1g.
6-(4-methoxyphenyl)-3-methylimidazo[2,1-b][1,3]thiazole-2-carboxylic acid (CAS 1131580-22-7) is a chemical compound with the molecular formula C14H12N2O3S and a molecular weight of 288.32 g/mol. IUPAC name: 6-(4-methoxyphenyl)-3-methylimidazo[2,1-b][1,3]thiazole-2-carboxylic acid. InChIKey: YVGSXXYSEUJPIS-UHFFFAOYSA-N.
| Molecular formula | C14H12N2O3S |
|---|---|
| Molecular weight | 288.32 g/mol |
| IUPAC name | 6-(4-methoxyphenyl)-3-methylimidazo[2,1-b][1,3]thiazole-2-carboxylic acid |
| InChIKey | YVGSXXYSEUJPIS-UHFFFAOYSA-N |
| SMILES | CC1=C(SC2=NC(=CN12)C3=CC=C(C=C3)OC)C(=O)O |
Computed by PubChem (NCBI)