CAS 372077-49-1 is the registry number for 5–Methoxy–1–(phenylsulfonyl)–1H–pyrrolo(3,2–b)pyridine. Offered by: GLPBio. Available pack sizes: 100mg.
1-(benzenesulfonyl)-5-methoxypyrrolo[3,2-b]pyridine (CAS 372077-49-1) is a chemical compound with the molecular formula C14H12N2O3S and a molecular weight of 288.32 g/mol. IUPAC name: 1-(benzenesulfonyl)-5-methoxypyrrolo[3,2-b]pyridine. InChIKey: DBGCFODVQKTQKT-UHFFFAOYSA-N.
| Molecular formula | C14H12N2O3S |
|---|---|
| Molecular weight | 288.32 g/mol |
| IUPAC name | 1-(benzenesulfonyl)-5-methoxypyrrolo[3,2-b]pyridine |
| InChIKey | DBGCFODVQKTQKT-UHFFFAOYSA-N |
| SMILES | COC1=NC2=C(C=C1)N(C=C2)S(=O)(=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)