Products 1341053-80-2
CAS 1341053-80-2 is the registry number for 5-Amino-2-benzyl-2,3-dihydro-1λâ¶,2-benzothiazole-1,1,3-trione. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
5-amino-2-benzyl-1,1-dioxo-1,2-benzothiazol-3-one (CAS 1341053-80-2) is a chemical compound with the molecular formula C14H12N2O3S and a molecular weight of 288.32 g/mol. IUPAC name: 5-amino-2-benzyl-1,1-dioxo-1,2-benzothiazol-3-one. InChIKey: JQXMZIKFARBGHD-UHFFFAOYSA-N.
| Molecular formula | C14H12N2O3S |
|---|---|
| Molecular weight | 288.32 g/mol |
| IUPAC name | 5-amino-2-benzyl-1,1-dioxo-1,2-benzothiazol-3-one |
| InChIKey | JQXMZIKFARBGHD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C(=O)C3=C(S2(=O)=O)C=CC(=C3)N |
Computed by PubChem (NCBI)