CAS 890600-31-4 is the registry number for 3-Isopropyl-6-(thiophen-2-yl)isoxazolo[5,4-b]pyridine-4-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-propan-2-yl-6-thiophen-2-yl-[1,2]oxazolo[5,4-b]pyridine-4-carboxylic acid (CAS 890600-31-4) is a chemical compound with the molecular formula C14H12N2O3S and a molecular weight of 288.32 g/mol. IUPAC name: 3-propan-2-yl-6-thiophen-2-yl-[1,2]oxazolo[5,4-b]pyridine-4-carboxylic acid. InChIKey: SLSUVHIWUQCBNC-UHFFFAOYSA-N.
| Molecular formula | C14H12N2O3S |
|---|---|
| Molecular weight | 288.32 g/mol |
| IUPAC name | 3-propan-2-yl-6-thiophen-2-yl-[1,2]oxazolo[5,4-b]pyridine-4-carboxylic acid |
| InChIKey | SLSUVHIWUQCBNC-UHFFFAOYSA-N |
| SMILES | CC(C)C1=NOC2=C1C(=CC(=N2)C3=CC=CS3)C(=O)O |
Computed by PubChem (NCBI)