Products 2485020-27-5
CAS 2485020-27-5 appears in our catalog under these names: 1-((4-Methoxyphenyl)sulfonyl)-1H-pyrrolo[2,3-b]pyridine, 95%, 95%, 1-((4-Methoxyphenyl)sulfonyl)-1H-pyrrolo[2,3-b]pyridine, 95%. Offered by: Chemat, Ambeed. Available pack sizes: 250mg, 1g, 5g.
1-(4-methoxyphenyl)sulfonylpyrrolo[2,3-b]pyridine (CAS 2485020-27-5) is a chemical compound with the molecular formula C14H12N2O3S and a molecular weight of 288.32 g/mol. IUPAC name: 1-(4-methoxyphenyl)sulfonylpyrrolo[2,3-b]pyridine. InChIKey: LWEARHMVFHZZCX-UHFFFAOYSA-N.
| Molecular formula | C14H12N2O3S |
|---|---|
| Molecular weight | 288.32 g/mol |
| IUPAC name | 1-(4-methoxyphenyl)sulfonylpyrrolo[2,3-b]pyridine |
| InChIKey | LWEARHMVFHZZCX-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)S(=O)(=O)N2C=CC3=C2N=CC=C3 |
Computed by PubChem (NCBI)