Products 1886961-39-2

CAS 1886961-39-2 is the registry number for Febuxostat Impurity W. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-(3-cyano-4-ethoxyphenyl)-4-methyl-1,3-thiazole-5-carboxylic acid (CAS 1886961-39-2) is a chemical compound with the molecular formula C14H12N2O3S and a molecular weight of 288.32 g/mol. IUPAC name: 2-(3-cyano-4-ethoxyphenyl)-4-methyl-1,3-thiazole-5-carboxylic acid. InChIKey: QTDQNBLMXFOOKT-UHFFFAOYSA-N.

Identity
Molecular formulaC14H12N2O3S
Molecular weight288.32 g/mol
IUPAC name2-(3-cyano-4-ethoxyphenyl)-4-methyl-1,3-thiazole-5-carboxylic acid
InChIKeyQTDQNBLMXFOOKT-UHFFFAOYSA-N
SMILESCCOC1=C(C=C(C=C1)C2=NC(=C(S2)C(=O)O)C)C#N

Computed by PubChem (NCBI)