CAS 756859-00-4 is the registry number for (2E)-3-(2-[Acetyl(phenyl)amino]-1,3-thiazol-4-yl)acrylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.
(E)-3-[2-(N-acetylanilino)-1,3-thiazol-4-yl]prop-2-enoic acid (CAS 756859-00-4) is a chemical compound with the molecular formula C14H12N2O3S and a molecular weight of 288.32 g/mol. IUPAC name: (E)-3-[2-(N-acetylanilino)-1,3-thiazol-4-yl]prop-2-enoic acid. InChIKey: VSMIOQNPRCYJKR-BQYQJAHWSA-N.
| Molecular formula | C14H12N2O3S |
|---|---|
| Molecular weight | 288.32 g/mol |
| IUPAC name | (E)-3-[2-(N-acetylanilino)-1,3-thiazol-4-yl]prop-2-enoic acid |
| InChIKey | VSMIOQNPRCYJKR-BQYQJAHWSA-N |
| SMILES | CC(=O)N(C1=CC=CC=C1)C2=NC(=CS2)/C=C/C(=O)O |
Computed by PubChem (NCBI)