CAS 1131890-85-1 is the registry number for 2-Chloro-5-methylphenyl trifluoromethanesulfonate, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g.
(2-chloro-5-methylphenyl) trifluoromethanesulfonate (CAS 1131890-85-1) is a chemical compound with the molecular formula C8H6ClF3O3S and a molecular weight of 274.65 g/mol. IUPAC name: (2-chloro-5-methylphenyl) trifluoromethanesulfonate. InChIKey: OEQGOIJYEQCOQR-UHFFFAOYSA-N.
| Molecular formula | C8H6ClF3O3S |
|---|---|
| Molecular weight | 274.65 g/mol |
| IUPAC name | (2-chloro-5-methylphenyl) trifluoromethanesulfonate |
| InChIKey | OEQGOIJYEQCOQR-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)Cl)OS(=O)(=O)C(F)(F)F |
Computed by PubChem (NCBI)