Products 1261852-46-3
CAS 1261852-46-3 is the registry number for 2-Methyl-5-(trifluoromethoxy)benzenesulfonyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
2-methyl-5-(trifluoromethoxy)benzenesulfonyl chloride (CAS 1261852-46-3) is a chemical compound with the molecular formula C8H6ClF3O3S and a molecular weight of 274.65 g/mol. IUPAC name: 2-methyl-5-(trifluoromethoxy)benzenesulfonyl chloride. InChIKey: GUMMDXAWVBRQPV-UHFFFAOYSA-N.
| Molecular formula | C8H6ClF3O3S |
|---|---|
| Molecular weight | 274.65 g/mol |
| IUPAC name | 2-methyl-5-(trifluoromethoxy)benzenesulfonyl chloride |
| InChIKey | GUMMDXAWVBRQPV-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)OC(F)(F)F)S(=O)(=O)Cl |
Computed by PubChem (NCBI)