Products 775288-85-2

CAS 775288-85-2 appears in our catalog under these names: 4-Methoxy-2-(trifluoromethyl)benzenesulfonyl chloride, 95%, 4-Methoxy-2-(trifluoromethyl)-benzenesulfonyl chloride, 98+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 100mg, 5g, 10g.

Structural formula: {0} (CAS {1})

4-methoxy-2-(trifluoromethyl)benzenesulfonyl chloride (CAS 775288-85-2) is a chemical compound with the molecular formula C8H6ClF3O3S and a molecular weight of 274.65 g/mol. IUPAC name: 4-methoxy-2-(trifluoromethyl)benzenesulfonyl chloride. InChIKey: XOLLWGQBRDQKPX-UHFFFAOYSA-N.

Identity
Molecular formulaC8H6ClF3O3S
Molecular weight274.65 g/mol
IUPAC name4-methoxy-2-(trifluoromethyl)benzenesulfonyl chloride
InChIKeyXOLLWGQBRDQKPX-UHFFFAOYSA-N
SMILESCOC1=CC(=C(C=C1)S(=O)(=O)Cl)C(F)(F)F

Computed by PubChem (NCBI)