Products 612541-12-5
CAS 612541-12-5 appears in our catalog under these names: 2-Methoxy-5-(trifluoromethyl)benzenesulfonyl chloride, 95%, 2-Methoxy-5-(trifluoromethyl)-benzenesulfonyl chloride, 95+%. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 1g, 250mg, 5g.
2-methoxy-5-(trifluoromethyl)benzenesulfonyl chloride (CAS 612541-12-5) is a chemical compound with the molecular formula C8H6ClF3O3S and a molecular weight of 274.65 g/mol. IUPAC name: 2-methoxy-5-(trifluoromethyl)benzenesulfonyl chloride. InChIKey: LMOADGGLIGJXFZ-UHFFFAOYSA-N.
| Molecular formula | C8H6ClF3O3S |
|---|---|
| Molecular weight | 274.65 g/mol |
| IUPAC name | 2-methoxy-5-(trifluoromethyl)benzenesulfonyl chloride |
| InChIKey | LMOADGGLIGJXFZ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C(F)(F)F)S(=O)(=O)Cl |
Computed by PubChem (NCBI)