Products 1365941-75-8
CAS 1365941-75-8 is the registry number for 3-(2,2,2-Trifluoro-ethoxy)-benzenesulfonyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 250mg.
3-(2,2,2-trifluoroethoxy)benzenesulfonyl chloride (CAS 1365941-75-8) is a chemical compound with the molecular formula C8H6ClF3O3S and a molecular weight of 274.65 g/mol. IUPAC name: 3-(2,2,2-trifluoroethoxy)benzenesulfonyl chloride. InChIKey: FTYPCJRSPCKLRO-UHFFFAOYSA-N.
| Molecular formula | C8H6ClF3O3S |
|---|---|
| Molecular weight | 274.65 g/mol |
| IUPAC name | 3-(2,2,2-trifluoroethoxy)benzenesulfonyl chloride |
| InChIKey | FTYPCJRSPCKLRO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)S(=O)(=O)Cl)OCC(F)(F)F |
Computed by PubChem (NCBI)